Organic acids and derivatives
Filtered Search Results
Benzyl dimethyl phosphonoacetate, 98%
CAS: 57443-18-2 Molecular Formula: C11H15O5P Molecular Weight (g/mol): 258.21 MDL Number: MFCD01872507 InChI Key: QYLGNJMIOVHLQQ-UHFFFAOYSA-N Synonym: benzyl dimethylphosphonoacetate,benzyl 2-dimethoxyphosphoryl acetate,benzyl dimethyl phosphonoacetate,dimethyl benzyloxycarbonyl methyl phosphonate,acetic acid, dimethoxyphosphinyl-, phenylmethyl ester,acmc-209ly9,benzyl dimethylphosphonoethanoate,dimethyl cbz-methyl phosphonate,benzyl dimethoxyphosphoryl acetate,benzyl-2-dimethoxyphosphoryl acetate PubChem CID: 2773759 IUPAC Name: benzyl 2-dimethoxyphosphorylacetate SMILES: COP(=O)(CC(=O)OCC1=CC=CC=C1)OC
| PubChem CID | 2773759 |
|---|---|
| CAS | 57443-18-2 |
| Molecular Weight (g/mol) | 258.21 |
| MDL Number | MFCD01872507 |
| SMILES | COP(=O)(CC(=O)OCC1=CC=CC=C1)OC |
| Synonym | benzyl dimethylphosphonoacetate,benzyl 2-dimethoxyphosphoryl acetate,benzyl dimethyl phosphonoacetate,dimethyl benzyloxycarbonyl methyl phosphonate,acetic acid, dimethoxyphosphinyl-, phenylmethyl ester,acmc-209ly9,benzyl dimethylphosphonoethanoate,dimethyl cbz-methyl phosphonate,benzyl dimethoxyphosphoryl acetate,benzyl-2-dimethoxyphosphoryl acetate |
| IUPAC Name | benzyl 2-dimethoxyphosphorylacetate |
| InChI Key | QYLGNJMIOVHLQQ-UHFFFAOYSA-N |
| Molecular Formula | C11H15O5P |
Methyl 4-bromocrotonate, tech. 85%
CAS: 1117-71-1 Molecular Formula: C5H7BrO2 Molecular Weight (g/mol): 179.01 MDL Number: MFCD00000246,MFCD09998308 InChI Key: RWIKCBHOVNDESJ-NSCUHMNNSA-N Synonym: methyl 4-bromocrotonate,e-methyl 4-bromobut-2-enoate,4-bromocrotonic acid methyl ester,methyl gamma-bromocrotonate,methyl bromocrotonate,methyl 4-bromo-2-butenoate,2-butenoic acid, 4-bromo-, methyl ester,methyl 4-bromobut-2-enoate,methyl 2e-4-bromobut-2-enoate,crotonic acid, 4-bromo-, methyl ester PubChem CID: 5369175 IUPAC Name: methyl (E)-4-bromobut-2-enoate SMILES: COC(=O)\C=C\CBr
| PubChem CID | 5369175 |
|---|---|
| CAS | 1117-71-1 |
| Molecular Weight (g/mol) | 179.01 |
| MDL Number | MFCD00000246,MFCD09998308 |
| SMILES | COC(=O)\C=C\CBr |
| Synonym | methyl 4-bromocrotonate,e-methyl 4-bromobut-2-enoate,4-bromocrotonic acid methyl ester,methyl gamma-bromocrotonate,methyl bromocrotonate,methyl 4-bromo-2-butenoate,2-butenoic acid, 4-bromo-, methyl ester,methyl 4-bromobut-2-enoate,methyl 2e-4-bromobut-2-enoate,crotonic acid, 4-bromo-, methyl ester |
| IUPAC Name | methyl (E)-4-bromobut-2-enoate |
| InChI Key | RWIKCBHOVNDESJ-NSCUHMNNSA-N |
| Molecular Formula | C5H7BrO2 |
Methyl 2-methoxybenzoate, 98+%
CAS: 606-45-1 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00008423 InChI Key: PFYHAAAQPNMZHO-UHFFFAOYSA-N Synonym: methyl o-anisate,dimethyl salicylate,o-anisic acid, methyl ester,methyl o-methoxybenzoate,o-methoxy methyl benzoate,o-methoxybenzoic acid methyl ester,methylsalicylate methyl ether,2-methoxybenzoic acid methyl ester,benzoic acid, 2-methoxy-, methyl ester,2-methoxybenzoic acid, methyl ester PubChem CID: 61151 IUPAC Name: methyl 2-methoxybenzoate SMILES: COC1=CC=CC=C1C(=O)OC
| PubChem CID | 61151 |
|---|---|
| CAS | 606-45-1 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00008423 |
| SMILES | COC1=CC=CC=C1C(=O)OC |
| Synonym | methyl o-anisate,dimethyl salicylate,o-anisic acid, methyl ester,methyl o-methoxybenzoate,o-methoxy methyl benzoate,o-methoxybenzoic acid methyl ester,methylsalicylate methyl ether,2-methoxybenzoic acid methyl ester,benzoic acid, 2-methoxy-, methyl ester,2-methoxybenzoic acid, methyl ester |
| IUPAC Name | methyl 2-methoxybenzoate |
| InChI Key | PFYHAAAQPNMZHO-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |
Methyl 4-chlorocinnamate, 99%
CAS: 7560-44-3 Molecular Formula: C10H9ClO2 Molecular Weight (g/mol): 196.63 MDL Number: MFCD00075790 InChI Key: IIBXQGYKZKOORG-QPJJXVBHSA-N Synonym: methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate PubChem CID: 5314314 IUPAC Name: methyl (E)-3-(4-chlorophenyl)prop-2-enoate SMILES: COC(=O)C=CC1=CC=C(C=C1)Cl
| PubChem CID | 5314314 |
|---|---|
| CAS | 7560-44-3 |
| Molecular Weight (g/mol) | 196.63 |
| MDL Number | MFCD00075790 |
| SMILES | COC(=O)C=CC1=CC=C(C=C1)Cl |
| Synonym | methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate |
| IUPAC Name | methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChI Key | IIBXQGYKZKOORG-QPJJXVBHSA-N |
| Molecular Formula | C10H9ClO2 |
Ethyl crotonate, 98%
CAS: 623-70-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009289 InChI Key: ZFDIRQKJPRINOQ-HWKANZROSA-N Synonym: ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e PubChem CID: 429065 IUPAC Name: ethyl (E)-but-2-enoate SMILES: CCOC(=O)\C=C\C
| PubChem CID | 429065 |
|---|---|
| CAS | 623-70-1 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009289 |
| SMILES | CCOC(=O)\C=C\C |
| Synonym | ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e |
| IUPAC Name | ethyl (E)-but-2-enoate |
| InChI Key | ZFDIRQKJPRINOQ-HWKANZROSA-N |
| Molecular Formula | C6H10O2 |
Methyl 4-bromocrotonate, 85%, tech.
CAS: 1117-71-1 Molecular Formula: C5H7BrO2 Molecular Weight (g/mol): 179.01 MDL Number: MFCD00000246,MFCD09998308 InChI Key: RWIKCBHOVNDESJ-NSCUHMNNSA-N Synonym: methyl 4-bromocrotonate,e-methyl 4-bromobut-2-enoate,4-bromocrotonic acid methyl ester,methyl gamma-bromocrotonate,methyl bromocrotonate,methyl 4-bromo-2-butenoate,2-butenoic acid, 4-bromo-, methyl ester,methyl 4-bromobut-2-enoate,methyl 2e-4-bromobut-2-enoate,crotonic acid, 4-bromo-, methyl ester PubChem CID: 5369175 SMILES: COC(=O)\C=C\CBr
| PubChem CID | 5369175 |
|---|---|
| CAS | 1117-71-1 |
| Molecular Weight (g/mol) | 179.01 |
| MDL Number | MFCD00000246,MFCD09998308 |
| SMILES | COC(=O)\C=C\CBr |
| Synonym | methyl 4-bromocrotonate,e-methyl 4-bromobut-2-enoate,4-bromocrotonic acid methyl ester,methyl gamma-bromocrotonate,methyl bromocrotonate,methyl 4-bromo-2-butenoate,2-butenoic acid, 4-bromo-, methyl ester,methyl 4-bromobut-2-enoate,methyl 2e-4-bromobut-2-enoate,crotonic acid, 4-bromo-, methyl ester |
| InChI Key | RWIKCBHOVNDESJ-NSCUHMNNSA-N |
| Molecular Formula | C5H7BrO2 |
Methyl 3-(methylthio)propionate, 98%
CAS: 13532-18-8 Molecular Formula: C5H10O2S Molecular Weight (g/mol): 134.19 MDL Number: MFCD00008565 InChI Key: DMMJVMYCBULSIS-UHFFFAOYSA-N Synonym: methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate PubChem CID: 61641 IUPAC Name: methyl 3-methylsulfanylpropanoate SMILES: COC(=O)CCSC
| PubChem CID | 61641 |
|---|---|
| CAS | 13532-18-8 |
| Molecular Weight (g/mol) | 134.19 |
| MDL Number | MFCD00008565 |
| SMILES | COC(=O)CCSC |
| Synonym | methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate |
| IUPAC Name | methyl 3-methylsulfanylpropanoate |
| InChI Key | DMMJVMYCBULSIS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2S |
Diphenylborinic acid 2-aminoethyl ester, 98%
CAS: 524-95-8 Molecular Formula: C14H16BNO Molecular Weight (g/mol): 225.10 MDL Number: MFCD00014823 InChI Key: BLZVCIGGICSWIG-UHFFFAOYSA-N Synonym: 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl PubChem CID: 1598 SMILES: NCCOB(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 1598 |
|---|---|
| CAS | 524-95-8 |
| Molecular Weight (g/mol) | 225.10 |
| MDL Number | MFCD00014823 |
| SMILES | NCCOB(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl |
| InChI Key | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Molecular Formula | C14H16BNO |
3-Nitrobenzamide, 98%
CAS: 645-09-0 Molecular Formula: C7H6N2O3 Molecular Weight (g/mol): 166.14 MDL Number: MFCD00007984 InChI Key: KWAYEPXDGHYGRW-UHFFFAOYSA-N Synonym: m-nitrobenzamide,benzamide, 3-nitro,benzamide, m-nitro,3-nitro-benzamide,3-nitrophenylcarboxamide,acmc-209nmr,3-nitrobenzamide,dsstox_cid_5732,dsstox_rid_77897,dsstox_gsid_25732 PubChem CID: 12576 IUPAC Name: 3-nitrobenzamide SMILES: C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N
| PubChem CID | 12576 |
|---|---|
| CAS | 645-09-0 |
| Molecular Weight (g/mol) | 166.14 |
| MDL Number | MFCD00007984 |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N |
| Synonym | m-nitrobenzamide,benzamide, 3-nitro,benzamide, m-nitro,3-nitro-benzamide,3-nitrophenylcarboxamide,acmc-209nmr,3-nitrobenzamide,dsstox_cid_5732,dsstox_rid_77897,dsstox_gsid_25732 |
| IUPAC Name | 3-nitrobenzamide |
| InChI Key | KWAYEPXDGHYGRW-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2O3 |
Triethyl methanetricarboxylate, 98%
CAS: 6279-86-3 Molecular Formula: C10H16O6 Molecular Weight (g/mol): 232.23 InChI Key: AGZPNUZBDCYTBB-UHFFFAOYSA-N Synonym: tricarbethoxymethane,triethylmethanetricarboxylate,methanetricarboxylic acid, triethyl ester,2-ethoxycarbonyl-malonic acid diethyl ester,methanetricarboxylic acid triethyl ester,carboxymalonic acid triethyl ester,diethyl 2-ethoxycarbonyl malonate,diethyl 2-ethoxycarbonyl propane-1,3-dioate,pubchem3106,triethoxycarbonylmethane PubChem CID: 80471 IUPAC Name: triethyl methanetricarboxylate SMILES: CCOC(=O)C(C(=O)OCC)C(=O)OCC
| PubChem CID | 80471 |
|---|---|
| CAS | 6279-86-3 |
| Molecular Weight (g/mol) | 232.23 |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)OCC |
| Synonym | tricarbethoxymethane,triethylmethanetricarboxylate,methanetricarboxylic acid, triethyl ester,2-ethoxycarbonyl-malonic acid diethyl ester,methanetricarboxylic acid triethyl ester,carboxymalonic acid triethyl ester,diethyl 2-ethoxycarbonyl malonate,diethyl 2-ethoxycarbonyl propane-1,3-dioate,pubchem3106,triethoxycarbonylmethane |
| IUPAC Name | triethyl methanetricarboxylate |
| InChI Key | AGZPNUZBDCYTBB-UHFFFAOYSA-N |
| Molecular Formula | C10H16O6 |
Ethyl 5-amino-1-methyl-1H-pyrazole-4-carboxylate, 98%
CAS: 31037-02-2 Molecular Formula: C7H11N3O2 Molecular Weight (g/mol): 169.18 MDL Number: MFCD00051652 InChI Key: MEUSJJFWVKBUFP-UHFFFAOYSA-N Synonym: ethyl 5-amino-1-methyl-1h-pyrazole-4-carboxylate,5-amino-1-methyl-1h-pyrazole-4-carboxylic acid ethyl ester,ethyl5-amino-1-methylpyrazole-4-carboxylate,1h-pyrazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester,5-amino-1-methylpyrazole-4-carboxylic acid ethyl ester,ethyl 5-amino-1-methyl-4-pyrazolecarboxylate,ethyl 5-amino-1-methyl-pyrazole-4-carboxylate,acmc-1agpk,maybridge1_003833,ethyl-5-amino-1-methyl-1h-pyrazol-4-carboxylat PubChem CID: 271299 IUPAC Name: ethyl 5-amino-1-methylpyrazole-4-carboxylate SMILES: CCOC(=O)C1=C(N)N(C)N=C1
| PubChem CID | 271299 |
|---|---|
| CAS | 31037-02-2 |
| Molecular Weight (g/mol) | 169.18 |
| MDL Number | MFCD00051652 |
| SMILES | CCOC(=O)C1=C(N)N(C)N=C1 |
| Synonym | ethyl 5-amino-1-methyl-1h-pyrazole-4-carboxylate,5-amino-1-methyl-1h-pyrazole-4-carboxylic acid ethyl ester,ethyl5-amino-1-methylpyrazole-4-carboxylate,1h-pyrazole-4-carboxylic acid, 5-amino-1-methyl-, ethyl ester,5-amino-1-methylpyrazole-4-carboxylic acid ethyl ester,ethyl 5-amino-1-methyl-4-pyrazolecarboxylate,ethyl 5-amino-1-methyl-pyrazole-4-carboxylate,acmc-1agpk,maybridge1_003833,ethyl-5-amino-1-methyl-1h-pyrazol-4-carboxylat |
| IUPAC Name | ethyl 5-amino-1-methylpyrazole-4-carboxylate |
| InChI Key | MEUSJJFWVKBUFP-UHFFFAOYSA-N |
| Molecular Formula | C7H11N3O2 |
Sodium Potassium Tartrate, Tetrahydrate, Powder, FCC, 99-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-59-5 Molecular Formula: C4H12KNaO10 Molecular Weight (g/mol): 282.22 InChI Key: VZOPRCCTKLAGPN-ZFJVMAEJSA-L IUPAC Name: potassium sodium (2R,3R)-2,3-dihydroxybutanedioate tetrahydrate SMILES: O.O.O.O.[Na+].[K+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O
| CAS | 6381-59-5 |
|---|---|
| Molecular Weight (g/mol) | 282.22 |
| SMILES | O.O.O.O.[Na+].[K+].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| IUPAC Name | potassium sodium (2R,3R)-2,3-dihydroxybutanedioate tetrahydrate |
| InChI Key | VZOPRCCTKLAGPN-ZFJVMAEJSA-L |
| Molecular Formula | C4H12KNaO10 |
Sodium formate, 99%
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.007 MDL Number: MFCD00013101 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.007 |
| ChEBI | CHEBI:62965 |
| MDL Number | MFCD00013101 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
2-Sulfobenzoic acid cyclic anhydride, 95%
CAS: 81-08-3 Molecular Formula: C7H4O4S Molecular Weight (g/mol): 184.17 MDL Number: MFCD00005879 InChI Key: NCYNKWQXFADUOZ-UHFFFAOYSA-N Synonym: 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w PubChem CID: 65729 IUPAC Name: 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one SMILES: C1=CC=C2C(=C1)C(=O)OS2(=O)=O
| PubChem CID | 65729 |
|---|---|
| CAS | 81-08-3 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00005879 |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| Synonym | 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w |
| IUPAC Name | 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
| InChI Key | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| Molecular Formula | C7H4O4S |
N-Benzoyl-N-phenylhydroxylamine, 98%
CAS: 304-88-1 Molecular Formula: C13H11NO2 Molecular Weight (g/mol): 213.24 MDL Number: MFCD00002111 InChI Key: YLYIXDZITBMCIW-UHFFFAOYSA-N Synonym: n-benzoyl-n-phenylhydroxylamine,n-phenylbenzohydroxamic acid,n-hydroxybenzanilide,benzamide, n-hydroxy-n-phenyl,n-benzoyl-n-phenylhydroxamic acid,n-benzoylphenylhydroxylamine,benzohydroxamic acid, n-phenyl,tantalon,acmc-1cqm9,n-phenylbenzohydroxamicacid PubChem CID: 67536 IUPAC Name: N-hydroxy-N-phenylbenzamide SMILES: ON(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 67536 |
|---|---|
| CAS | 304-88-1 |
| Molecular Weight (g/mol) | 213.24 |
| MDL Number | MFCD00002111 |
| SMILES | ON(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | n-benzoyl-n-phenylhydroxylamine,n-phenylbenzohydroxamic acid,n-hydroxybenzanilide,benzamide, n-hydroxy-n-phenyl,n-benzoyl-n-phenylhydroxamic acid,n-benzoylphenylhydroxylamine,benzohydroxamic acid, n-phenyl,tantalon,acmc-1cqm9,n-phenylbenzohydroxamicacid |
| IUPAC Name | N-hydroxy-N-phenylbenzamide |
| InChI Key | YLYIXDZITBMCIW-UHFFFAOYSA-N |
| Molecular Formula | C13H11NO2 |